About 19-aminooxynonadecanoic acid
19-aminooxynonadecanoic acid (PubChem CID 145081852) has the molecular formula C19H39NO3
and a molecular weight of 329.53 g/mol. Its IUPAC name is 19-aminooxynonadecanoic acid.
Molecular Properties
| Compound Name | 19-aminooxynonadecanoic acid |
| PubChem CID | 145081852 |
| Molecular Formula | C19H39NO3 |
| Molecular Weight | 329.53 g/mol |
| Exact Mass | 329.29 |
| IUPAC Name | 19-aminooxynonadecanoic acid |
| SMILES | NOCCCCCCCCCCCCCCCCCCC(=O)O |
| InChI | InChI=1S/C19H39NO3/c20-23-18-16-14-12-10-8-6-4-2-1-3-5-7-9-11-13-15-17-19(21)22/h1-18,20H2,(H,21,22) |
| InChIKey | WYUQHBJDMLVFNY-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 329.53 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 19-aminooxynonadecanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 19-aminooxynonadecanoic acid?
The IUPAC name of 19-aminooxynonadecanoic acid (CID 145081852) is 19-aminooxynonadecanoic acid.
What is the SMILES notation for 19-aminooxynonadecanoic acid?
The canonical SMILES for 19-aminooxynonadecanoic acid is NOCCCCCCCCCCCCCCCCCCC(=O)O.
What is the InChIKey of 19-aminooxynonadecanoic acid?
The InChIKey is WYUQHBJDMLVFNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H39NO3/c20-23-18-16-14-12-10-8-6-4-2-1-3-5-7-9-11-13-15-17-19(21)22/h1-18,20H2,(H,21,22).
What are the key properties of 19-aminooxynonadecanoic acid?
19-aminooxynonadecanoic acid has a molecular weight of 329.53 g/mol, XLogP of 5.59, 19 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 19-aminooxynonadecanoic acid is sourced from PubChem (CID 145081852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).