About 4-aminooxybutanoic acid;hydrochloride
4-aminooxybutanoic acid;hydrochloride (PubChem CID 71361272) has the molecular formula C4H10ClNO3
and a molecular weight of 155.58 g/mol. Its IUPAC name is 4-aminooxybutanoic acid;hydrochloride.
Molecular Properties
| Compound Name | 4-aminooxybutanoic acid;hydrochloride |
| PubChem CID | 71361272 |
| Molecular Formula | C4H10ClNO3 |
| Molecular Weight | 155.58 g/mol |
| Exact Mass | 155.03 |
| IUPAC Name | 4-aminooxybutanoic acid;hydrochloride |
| SMILES | Cl.NOCCCC(=O)O |
| InChI | InChI=1S/C4H9NO3.ClH/c5-8-3-1-2-4(6)7;/h1-3,5H2,(H,6,7);1H |
| InChIKey | YHRQKRFZKOHLBA-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.58 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-aminooxybutanoic acid;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-aminooxybutanoic acid;hydrochloride?
The IUPAC name of 4-aminooxybutanoic acid;hydrochloride (CID 71361272) is 4-aminooxybutanoic acid;hydrochloride.
What is the SMILES notation for 4-aminooxybutanoic acid;hydrochloride?
The canonical SMILES for 4-aminooxybutanoic acid;hydrochloride is Cl.NOCCCC(=O)O.
What is the InChIKey of 4-aminooxybutanoic acid;hydrochloride?
The InChIKey is YHRQKRFZKOHLBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9NO3.ClH/c5-8-3-1-2-4(6)7;/h1-3,5H2,(H,6,7);1H.
What are the key properties of 4-aminooxybutanoic acid;hydrochloride?
4-aminooxybutanoic acid;hydrochloride has a molecular weight of 155.58 g/mol, XLogP of 0.16, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-aminooxybutanoic acid;hydrochloride is sourced from PubChem (CID 71361272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).