C21H24O4 — CID 14995046
methyl 3-[5-(4-hydroxyphenyl)-3,3-dimethyl-5-oxopentyl]benzoate (PubChem CID 14995046) has the molecular formula C21H24O4 and a molecular weight of 340.42 g/mol. Its IUPAC name is methyl 3-[5-(4-hydroxyphenyl)-3,3-dimethyl-5-oxopentyl]benzoate.
| Compound Name | methyl 3-[5-(4-hydroxyphenyl)-3,3-dimethyl-5-oxopentyl]benzoate |
|---|---|
| PubChem CID | 14995046 |
| Molecular Formula | C21H24O4 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | methyl 3-[5-(4-hydroxyphenyl)-3,3-dimethyl-5-oxopentyl]benzoate |
| SMILES | COC(=O)c1cccc(CCC(C)(C)CC(=O)c2ccc(O)cc2)c1 |
| InChI | InChI=1S/C21H24O4/c1-21(2,14-19(23)16-7-9-18(22)10-8-16)12-11-15-5-4-6-17(13-15)20(24)25-3/h4-10,13,22H,11-12,14H2,1-3H3 |
| InChIKey | WWIJLXGLSOVOTG-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |