C25H30N4O2S — CID 14998813
N-[4-[(4-benzyl-1-phenylpiperazin-2-yl)methylamino]phenyl]methanesulfonamide (PubChem CID 14998813) has the molecular formula C25H30N4O2S and a molecular weight of 450.61 g/mol. Its IUPAC name is N-[4-[(4-benzyl-1-phenylpiperazin-2-yl)methylamino]phenyl]methanesulfonamide.
| Compound Name | N-[4-[(4-benzyl-1-phenylpiperazin-2-yl)methylamino]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 14998813 |
| Molecular Formula | C25H30N4O2S |
| Molecular Weight | 450.61 g/mol |
| Exact Mass | 450.21 |
| IUPAC Name | N-[4-[(4-benzyl-1-phenylpiperazin-2-yl)methylamino]phenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1ccc(NCC2CN(Cc3ccccc3)CCN2c2ccccc2)cc1 |
| InChI | InChI=1S/C25H30N4O2S/c1-32(30,31)27-23-14-12-22(13-15-23)26-18-25-20-28(19-21-8-4-2-5-9-21)16-17-29(25)24-10-6-3-7-11-24/h2-15,25-27H,16-20H2,1H3 |
| InChIKey | SYWQXBQXJVFEGQ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.61 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |