C25H29N3O3S — CID 14998805
N-[4-[(1-benzyl-4-phenylpiperazin-2-yl)methoxy]phenyl]methanesulfonamide (PubChem CID 14998805) has the molecular formula C25H29N3O3S and a molecular weight of 451.59 g/mol. Its IUPAC name is N-[4-[(1-benzyl-4-phenylpiperazin-2-yl)methoxy]phenyl]methanesulfonamide.
| Compound Name | N-[4-[(1-benzyl-4-phenylpiperazin-2-yl)methoxy]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 14998805 |
| Molecular Formula | C25H29N3O3S |
| Molecular Weight | 451.59 g/mol |
| Exact Mass | 451.19 |
| IUPAC Name | N-[4-[(1-benzyl-4-phenylpiperazin-2-yl)methoxy]phenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1ccc(OCC2CN(c3ccccc3)CCN2Cc2ccccc2)cc1 |
| InChI | InChI=1S/C25H29N3O3S/c1-32(29,30)26-22-12-14-25(15-13-22)31-20-24-19-28(23-10-6-3-7-11-23)17-16-27(24)18-21-8-4-2-5-9-21/h2-15,24,26H,16-20H2,1H3 |
| InChIKey | GCGOOXLZPPEODJ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.59 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |