C12H14N4O — CID 14999832
[3-[(2,4-diaminopyrimidin-5-yl)methyl]phenyl]methanol (PubChem CID 14999832) has the molecular formula C12H14N4O and a molecular weight of 230.27 g/mol. Its IUPAC name is [3-[(2,4-diaminopyrimidin-5-yl)methyl]phenyl]methanol.
| Compound Name | [3-[(2,4-diaminopyrimidin-5-yl)methyl]phenyl]methanol |
|---|---|
| PubChem CID | 14999832 |
| Molecular Formula | C12H14N4O |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | [3-[(2,4-diaminopyrimidin-5-yl)methyl]phenyl]methanol |
| SMILES | Nc1ncc(Cc2cccc(CO)c2)c(N)n1 |
| InChI | InChI=1S/C12H14N4O/c13-11-10(6-15-12(14)16-11)5-8-2-1-3-9(4-8)7-17/h1-4,6,17H,5,7H2,(H4,13,14,15,16) |
| InChIKey | LFEJRVMXZUZEDH-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 98.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |