C7H12N2 — CID 150001249
1-cyclopenta-2,4-dien-1-yl-1,2-dimethylhydrazine (PubChem CID 150001249) has the molecular formula C7H12N2 and a molecular weight of 124.19 g/mol. Its IUPAC name is 1-cyclopenta-2,4-dien-1-yl-1,2-dimethylhydrazine.
| Compound Name | 1-cyclopenta-2,4-dien-1-yl-1,2-dimethylhydrazine |
|---|---|
| PubChem CID | 150001249 |
| Molecular Formula | C7H12N2 |
| Molecular Weight | 124.19 g/mol |
| Exact Mass | 124.10 |
| IUPAC Name | 1-cyclopenta-2,4-dien-1-yl-1,2-dimethylhydrazine |
| SMILES | CNN(C)C1C=CC=C1 |
| InChI | InChI=1S/C7H12N2/c1-8-9(2)7-5-3-4-6-7/h3-8H,1-2H3 |
| InChIKey | DBIKQWVKVDQRFY-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 124.19 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|