C20H27F3O — CID 15002107
1-methyl-4-[4-[4-(trifluoromethoxy)cyclohexyl]cyclohexyl]benzene (PubChem CID 15002107) has the molecular formula C20H27F3O and a molecular weight of 340.43 g/mol. Its IUPAC name is 1-methyl-4-[4-[4-(trifluoromethoxy)cyclohexyl]cyclohexyl]benzene.
| Compound Name | 1-methyl-4-[4-[4-(trifluoromethoxy)cyclohexyl]cyclohexyl]benzene |
|---|---|
| PubChem CID | 15002107 |
| Molecular Formula | C20H27F3O |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | 1-methyl-4-[4-[4-(trifluoromethoxy)cyclohexyl]cyclohexyl]benzene |
| SMILES | Cc1ccc(C2CCC(C3CCC(OC(F)(F)F)CC3)CC2)cc1 |
| InChI | InChI=1S/C20H27F3O/c1-14-2-4-15(5-3-14)16-6-8-17(9-7-16)18-10-12-19(13-11-18)24-20(21,22)23/h2-5,16-19H,6-13H2,1H3 |
| InChIKey | OQUDTLULDSIIGB-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |