C16H26O6 — CID 15004391
triethyl (E)-2,4-dimethylpent-4-ene-1,1,5-tricarboxylate (PubChem CID 15004391) has the molecular formula C16H26O6 and a molecular weight of 314.38 g/mol. Its IUPAC name is triethyl (E)-2,4-dimethylpent-4-ene-1,1,5-tricarboxylate.
| Compound Name | triethyl (E)-2,4-dimethylpent-4-ene-1,1,5-tricarboxylate |
|---|---|
| PubChem CID | 15004391 |
| Molecular Formula | C16H26O6 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | triethyl (E)-2,4-dimethylpent-4-ene-1,1,5-tricarboxylate |
| SMILES | CCOC(=O)/C=C(\C)CC(C)C(C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C16H26O6/c1-6-20-13(17)10-11(4)9-12(5)14(15(18)21-7-2)16(19)22-8-3/h10,12,14H,6-9H2,1-5H3/b11-10+ |
| InChIKey | RHQNINSBSWSGEJ-ZHACJKMWSA-N |
| XLogP | 2.26 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|