C17H30O5 — CID 150095728
3-(4,4-diethoxy-2-methyloxan-2-yl)propyl 2-methylprop-2-enoate (PubChem CID 150095728) has the molecular formula C17H30O5 and a molecular weight of 314.42 g/mol. Its IUPAC name is 3-(4,4-diethoxy-2-methyloxan-2-yl)propyl 2-methylprop-2-enoate.
| Compound Name | 3-(4,4-diethoxy-2-methyloxan-2-yl)propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 150095728 |
| Molecular Formula | C17H30O5 |
| Molecular Weight | 314.42 g/mol |
| Exact Mass | 314.21 |
| IUPAC Name | 3-(4,4-diethoxy-2-methyloxan-2-yl)propyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCC1(C)CC(OCC)(OCC)CCO1 |
| InChI | InChI=1S/C17H30O5/c1-6-20-17(21-7-2)10-12-22-16(5,13-17)9-8-11-19-15(18)14(3)4/h3,6-13H2,1-2,4-5H3 |
| InChIKey | DUEIWWBACPYSBY-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.42 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|