C8H7F2N3O — CID 150103963
1-azido-2-ethoxy-3,5-difluorobenzene (PubChem CID 150103963) has the molecular formula C8H7F2N3O and a molecular weight of 199.16 g/mol. Its IUPAC name is 1-azido-2-ethoxy-3,5-difluorobenzene.
| Compound Name | 1-azido-2-ethoxy-3,5-difluorobenzene |
|---|---|
| PubChem CID | 150103963 |
| Molecular Formula | C8H7F2N3O |
| Molecular Weight | 199.16 g/mol |
| Exact Mass | 199.06 |
| IUPAC Name | 1-azido-2-ethoxy-3,5-difluorobenzene |
| SMILES | CCOc1c(F)cc(F)cc1N=[N+]=[N-] |
| InChI | InChI=1S/C8H7F2N3O/c1-2-14-8-6(10)3-5(9)4-7(8)12-13-11/h3-4H,2H2,1H3 |
| InChIKey | DVVPRKOUELVUER-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 57.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.16 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|