C33H39FN2O5Si — CID 150108480
5-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-[(2S,6R)-2,6-diethylmorpholin-4-yl]-7-fluoro-1,2-benzoxazole-3-carboxylic acid (PubChem CID 150108480) has the molecular formula C33H39FN2O5Si and a molecular weight of 590.77 g/mol. Its IUPAC name is 5-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-[(2S,6R)-2,6-diethylmorpholin-4-yl]-7-fluoro-1,2-benzoxazole-3-carboxylic acid.
| Compound Name | 5-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-[(2S,6R)-2,6-diethylmorpholin-4-yl]-7-fluoro-1,2-benzoxazole-3-carboxylic acid |
|---|---|
| PubChem CID | 150108480 |
| Molecular Formula | C33H39FN2O5Si |
| Molecular Weight | 590.77 g/mol |
| Exact Mass | 590.26 |
| IUPAC Name | 5-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-[(2S,6R)-2,6-diethylmorpholin-4-yl]-7-fluoro-1,2-benzoxazole-3-carboxylic acid |
| SMILES | CC[C@@H]1CN(c2c(CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)cc3c(C(=O)O)noc3c2F)C[C@H](CC)O1 |
| InChI | InChI=1S/C33H39FN2O5Si/c1-6-23-19-36(20-24(7-2)40-23)30-22(18-27-29(32(37)38)35-41-31(27)28(30)34)21-39-42(33(3,4)5,25-14-10-8-11-15-25)26-16-12-9-13-17-26/h8-18,23-24H,6-7,19-21H2,1-5H3,(H,37,38)/t23-,24+ |
| InChIKey | DWTCMEFOVOYAGQ-PSWAGMNNSA-N |
| XLogP | 6.14 |
| TPSA | 85.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.77 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|