C34H42FN3O5Si — CID 77291052
5-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-(2,6-dimethylmorpholin-4-yl)-7-fluoro-N-(2-methoxyethyl)-1,2-benzoxazole-3-carboxamide (PubChem CID 77291052) has the molecular formula C34H42FN3O5Si and a molecular weight of 619.81 g/mol. Its IUPAC name is 5-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-(2,6-dimethylmorpholin-4-yl)-7-fluoro-N-(2-methoxyethyl)-1,2-benzoxazole-3-carboxamide.
| Compound Name | 5-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-(2,6-dimethylmorpholin-4-yl)-7-fluoro-N-(2-methoxyethyl)-1,2-benzoxazole-3-carboxamide |
|---|---|
| PubChem CID | 77291052 |
| Molecular Formula | C34H42FN3O5Si |
| Molecular Weight | 619.81 g/mol |
| Exact Mass | 619.29 |
| IUPAC Name | 5-[[tert-butyl(diphenyl)silyl]oxymethyl]-6-(2,6-dimethylmorpholin-4-yl)-7-fluoro-N-(2-methoxyethyl)-1,2-benzoxazole-3-carboxamide |
| SMILES | COCCNC(=O)c1noc2c(F)c(N3CC(C)OC(C)C3)c(CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)cc12 |
| InChI | InChI=1S/C34H42FN3O5Si/c1-23-20-38(21-24(2)42-23)31-25(19-28-30(33(39)36-17-18-40-6)37-43-32(28)29(31)35)22-41-44(34(3,4)5,26-13-9-7-10-14-26)27-15-11-8-12-16-27/h7-16,19,23-24H,17-18,20-22H2,1-6H3,(H,36,39) |
| InChIKey | IPOFKTRCMKQLGG-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 86.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.81 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|