C32H39F2NO4Si — CID 87770548
methyl 2-[5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-(2,6-dimethylmorpholin-4-yl)-2,3-difluorophenyl]acetate (PubChem CID 87770548) has the molecular formula C32H39F2NO4Si and a molecular weight of 567.75 g/mol. Its IUPAC name is methyl 2-[5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-(2,6-dimethylmorpholin-4-yl)-2,3-difluorophenyl]acetate.
| Compound Name | methyl 2-[5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-(2,6-dimethylmorpholin-4-yl)-2,3-difluorophenyl]acetate |
|---|---|
| PubChem CID | 87770548 |
| Molecular Formula | C32H39F2NO4Si |
| Molecular Weight | 567.75 g/mol |
| Exact Mass | 567.26 |
| IUPAC Name | methyl 2-[5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-(2,6-dimethylmorpholin-4-yl)-2,3-difluorophenyl]acetate |
| SMILES | COC(=O)Cc1cc(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)c(N2CC(C)OC(C)C2)c(F)c1F |
| InChI | InChI=1S/C32H39F2NO4Si/c1-22-19-35(20-23(2)39-22)31-25(17-24(18-28(36)37-6)29(33)30(31)34)21-38-40(32(3,4)5,26-13-9-7-10-14-26)27-15-11-8-12-16-27/h7-17,22-23H,18-21H2,1-6H3 |
| InChIKey | HEYRKNZIAVAIMG-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.75 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|