C34H41F2N3O3Si — CID 86658060
[5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-2,3-difluorophenyl]-(3-methylimidazol-4-yl)methanol (PubChem CID 86658060) has the molecular formula C34H41F2N3O3Si and a molecular weight of 605.80 g/mol. Its IUPAC name is [5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-2,3-difluorophenyl]-(3-methylimidazol-4-yl)methanol.
| Compound Name | [5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-2,3-difluorophenyl]-(3-methylimidazol-4-yl)methanol |
|---|---|
| PubChem CID | 86658060 |
| Molecular Formula | C34H41F2N3O3Si |
| Molecular Weight | 605.80 g/mol |
| Exact Mass | 605.29 |
| IUPAC Name | [5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-2,3-difluorophenyl]-(3-methylimidazol-4-yl)methanol |
| SMILES | C[C@@H]1CN(c2c(CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)cc(C(O)c3cncn3C)c(F)c2F)C[C@H](C)O1 |
| InChI | InChI=1S/C34H41F2N3O3Si/c1-23-19-39(20-24(2)42-23)32-25(17-28(30(35)31(32)36)33(40)29-18-37-22-38(29)6)21-41-43(34(3,4)5,26-13-9-7-10-14-26)27-15-11-8-12-16-27/h7-18,22-24,33,40H,19-21H2,1-6H3/t23-,24+,33? |
| InChIKey | XTVJVMMBAUBYCQ-RZVXCUBUSA-N |
| XLogP | 5.47 |
| TPSA | 59.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.80 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|