C33H38ClFN2O3SSi — CID 86717852
[5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-chloro-4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-2-fluorophenyl]-(1,3-thiazol-5-yl)methanol (PubChem CID 86717852) has the molecular formula C33H38ClFN2O3SSi and a molecular weight of 625.28 g/mol. Its IUPAC name is [5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-chloro-4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-2-fluorophenyl]-(1,3-thiazol-5-yl)methanol.
| Compound Name | [5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-chloro-4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-2-fluorophenyl]-(1,3-thiazol-5-yl)methanol |
|---|---|
| PubChem CID | 86717852 |
| Molecular Formula | C33H38ClFN2O3SSi |
| Molecular Weight | 625.28 g/mol |
| Exact Mass | 624.20 |
| IUPAC Name | [5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-chloro-4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-2-fluorophenyl]-(1,3-thiazol-5-yl)methanol |
| SMILES | C[C@@H]1CN(c2c(CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)cc(C(O)c3cncs3)c(F)c2Cl)C[C@H](C)O1 |
| InChI | InChI=1S/C33H38ClFN2O3SSi/c1-22-18-37(19-23(2)40-22)31-24(16-27(30(35)29(31)34)32(38)28-17-36-21-41-28)20-39-42(33(3,4)5,25-12-8-6-9-13-25)26-14-10-7-11-15-26/h6-17,21-23,32,38H,18-20H2,1-5H3/t22-,23+,32? |
| InChIKey | JFQNEMRTAGYBKS-KYGBEAGPSA-N |
| XLogP | 6.71 |
| TPSA | 54.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.28 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|