C32H40ClFN2O4Si — CID 87398833
(NZ)-N-[1-[5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-chloro-4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-2-fluorophenyl]-2-methoxyethylidene]hydroxylamine (PubChem CID 87398833) has the molecular formula C32H40ClFN2O4Si and a molecular weight of 599.22 g/mol. Its IUPAC name is (NZ)-N-[1-[5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-chloro-4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-2-fluorophenyl]-2-methoxyethylidene]hydroxylamine.
| Compound Name | (NZ)-N-[1-[5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-chloro-4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-2-fluorophenyl]-2-methoxyethylidene]hydroxylamine |
|---|---|
| PubChem CID | 87398833 |
| Molecular Formula | C32H40ClFN2O4Si |
| Molecular Weight | 599.22 g/mol |
| Exact Mass | 598.24 |
| IUPAC Name | (NZ)-N-[1-[5-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-chloro-4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-2-fluorophenyl]-2-methoxyethylidene]hydroxylamine |
| SMILES | COC/C(=N\O)c1cc(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)c(N2C[C@@H](C)O[C@@H](C)C2)c(Cl)c1F |
| InChI | InChI=1S/C32H40ClFN2O4Si/c1-22-18-36(19-23(2)40-22)31-24(17-27(30(34)29(31)33)28(35-37)21-38-6)20-39-41(32(3,4)5,25-13-9-7-10-14-25)26-15-11-8-12-16-26/h7-17,22-23,37H,18-21H2,1-6H3/b35-28+/t22-,23+ |
| InChIKey | CNIJKXYUROQOGN-XBRIYBJJSA-N |
| XLogP | 5.99 |
| TPSA | 63.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.22 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|