C35H41F2N3O4Si — CID 90963030
N-[[5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-(2,6-dimethylmorpholin-4-yl)-2,3-difluorophenyl]-(3,5-dimethyl-1,2-oxazol-4-yl)methylidene]hydroxylamine (PubChem CID 90963030) has the molecular formula C35H41F2N3O4Si and a molecular weight of 633.81 g/mol. Its IUPAC name is N-[[5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-(2,6-dimethylmorpholin-4-yl)-2,3-difluorophenyl]-(3,5-dimethyl-1,2-oxazol-4-yl)methylidene]hydroxylamine.
| Compound Name | N-[[5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-(2,6-dimethylmorpholin-4-yl)-2,3-difluorophenyl]-(3,5-dimethyl-1,2-oxazol-4-yl)methylidene]hydroxylamine |
|---|---|
| PubChem CID | 90963030 |
| Molecular Formula | C35H41F2N3O4Si |
| Molecular Weight | 633.81 g/mol |
| Exact Mass | 633.28 |
| IUPAC Name | N-[[5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-(2,6-dimethylmorpholin-4-yl)-2,3-difluorophenyl]-(3,5-dimethyl-1,2-oxazol-4-yl)methylidene]hydroxylamine |
| SMILES | Cc1noc(C)c1C(=NO)c1cc(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)c(N2CC(C)OC(C)C2)c(F)c1F |
| InChI | InChI=1S/C35H41F2N3O4Si/c1-22-19-40(20-23(2)43-22)34-26(18-29(31(36)32(34)37)33(38-41)30-24(3)39-44-25(30)4)21-42-45(35(5,6)7,27-14-10-8-11-15-27)28-16-12-9-13-17-28/h8-18,22-23,41H,19-21H2,1-7H3 |
| InChIKey | ZUAMLIHRNGLEKF-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.81 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|