C34H36F2N4O3SSi — CID 87369096
5-[C-[5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-2,3-difluorophenyl]-N-hydroxycarbonimidoyl]-1,3-thiazole-4-carbonitrile (PubChem CID 87369096) has the molecular formula C34H36F2N4O3SSi and a molecular weight of 646.84 g/mol. Its IUPAC name is 5-[C-[5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-2,3-difluorophenyl]-N-hydroxycarbonimidoyl]-1,3-thiazole-4-carbonitrile.
| Compound Name | 5-[C-[5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-2,3-difluorophenyl]-N-hydroxycarbonimidoyl]-1,3-thiazole-4-carbonitrile |
|---|---|
| PubChem CID | 87369096 |
| Molecular Formula | C34H36F2N4O3SSi |
| Molecular Weight | 646.84 g/mol |
| Exact Mass | 646.22 |
| IUPAC Name | 5-[C-[5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-2,3-difluorophenyl]-N-hydroxycarbonimidoyl]-1,3-thiazole-4-carbonitrile |
| SMILES | C[C@@H]1CN(c2c(CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)cc(C(=NO)c3scnc3C#N)c(F)c2F)C[C@H](C)O1 |
| InChI | InChI=1S/C34H36F2N4O3SSi/c1-22-18-40(19-23(2)43-22)32-24(16-27(29(35)30(32)36)31(39-41)33-28(17-37)38-21-44-33)20-42-45(34(3,4)5,25-12-8-6-9-13-25)26-14-10-7-11-15-26/h6-16,21-23,41H,18-20H2,1-5H3/t22-,23+ |
| InChIKey | NFAKRYNMZQFRFW-ZRZAMGCNSA-N |
| XLogP | 6.21 |
| TPSA | 90.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.84 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|