C33H39F2N5O3Si — CID 87377188
N-[1-[5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-2,3-difluorophenyl]-2-(1,2,4-triazol-1-yl)ethylidene]hydroxylamine (PubChem CID 87377188) has the molecular formula C33H39F2N5O3Si and a molecular weight of 619.79 g/mol. Its IUPAC name is N-[1-[5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-2,3-difluorophenyl]-2-(1,2,4-triazol-1-yl)ethylidene]hydroxylamine.
| Compound Name | N-[1-[5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-2,3-difluorophenyl]-2-(1,2,4-triazol-1-yl)ethylidene]hydroxylamine |
|---|---|
| PubChem CID | 87377188 |
| Molecular Formula | C33H39F2N5O3Si |
| Molecular Weight | 619.79 g/mol |
| Exact Mass | 619.28 |
| IUPAC Name | N-[1-[5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-2,3-difluorophenyl]-2-(1,2,4-triazol-1-yl)ethylidene]hydroxylamine |
| SMILES | C[C@@H]1CN(c2c(CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)cc(C(Cn3cncn3)=NO)c(F)c2F)C[C@H](C)O1 |
| InChI | InChI=1S/C33H39F2N5O3Si/c1-23-17-39(18-24(2)43-23)32-25(16-28(30(34)31(32)35)29(38-41)19-40-22-36-21-37-40)20-42-44(33(3,4)5,26-12-8-6-9-13-26)27-14-10-7-11-15-27/h6-16,21-24,41H,17-20H2,1-5H3/t23-,24+ |
| InChIKey | GFAWIBYIIORSRC-PSWAGMNNSA-N |
| XLogP | 5.12 |
| TPSA | 85.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.79 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|