C34H37F2N3O3Si — CID 90790078
[5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-(2,6-dimethylmorpholin-4-yl)-2,3-difluorophenyl]-pyridazin-3-ylmethanone (PubChem CID 90790078) has the molecular formula C34H37F2N3O3Si and a molecular weight of 601.77 g/mol. Its IUPAC name is [5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-(2,6-dimethylmorpholin-4-yl)-2,3-difluorophenyl]-pyridazin-3-ylmethanone.
| Compound Name | [5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-(2,6-dimethylmorpholin-4-yl)-2,3-difluorophenyl]-pyridazin-3-ylmethanone |
|---|---|
| PubChem CID | 90790078 |
| Molecular Formula | C34H37F2N3O3Si |
| Molecular Weight | 601.77 g/mol |
| Exact Mass | 601.26 |
| IUPAC Name | [5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-(2,6-dimethylmorpholin-4-yl)-2,3-difluorophenyl]-pyridazin-3-ylmethanone |
| SMILES | CC1CN(c2c(CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)cc(C(=O)c3cccnn3)c(F)c2F)CC(C)O1 |
| InChI | InChI=1S/C34H37F2N3O3Si/c1-23-20-39(21-24(2)42-23)32-25(19-28(30(35)31(32)36)33(40)29-17-12-18-37-38-29)22-41-43(34(3,4)5,26-13-8-6-9-14-26)27-15-10-7-11-16-27/h6-19,23-24H,20-22H2,1-5H3 |
| InChIKey | RHVHYQNEBMTZMR-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.77 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|