C31H35F2NO5Si — CID 86658068
2-[5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-2,3-difluorophenyl]-2-oxoacetic acid (PubChem CID 86658068) has the molecular formula C31H35F2NO5Si and a molecular weight of 567.71 g/mol. Its IUPAC name is 2-[5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-2,3-difluorophenyl]-2-oxoacetic acid.
| Compound Name | 2-[5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-2,3-difluorophenyl]-2-oxoacetic acid |
|---|---|
| PubChem CID | 86658068 |
| Molecular Formula | C31H35F2NO5Si |
| Molecular Weight | 567.71 g/mol |
| Exact Mass | 567.23 |
| IUPAC Name | 2-[5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-2,3-difluorophenyl]-2-oxoacetic acid |
| SMILES | C[C@@H]1CN(c2c(CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)cc(C(=O)C(=O)O)c(F)c2F)C[C@H](C)O1 |
| InChI | InChI=1S/C31H35F2NO5Si/c1-20-17-34(18-21(2)39-20)28-22(16-25(26(32)27(28)33)29(35)30(36)37)19-38-40(31(3,4)5,23-12-8-6-9-13-23)24-14-10-7-11-15-24/h6-16,20-21H,17-19H2,1-5H3,(H,36,37)/t20-,21+ |
| InChIKey | UTHQIEKTEIKUMZ-OYRHEFFESA-N |
| XLogP | 4.92 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.71 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|