C29H36ClFN2O3Si — CID 77291465
[6-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-chloro-5-(2,6-dimethylmorpholin-4-yl)-3-fluoro-2-pyridinyl]methanol (PubChem CID 77291465) has the molecular formula C29H36ClFN2O3Si and a molecular weight of 543.16 g/mol. Its IUPAC name is [6-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-chloro-5-(2,6-dimethylmorpholin-4-yl)-3-fluoro-2-pyridinyl]methanol.
| Compound Name | [6-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-chloro-5-(2,6-dimethylmorpholin-4-yl)-3-fluoro-2-pyridinyl]methanol |
|---|---|
| PubChem CID | 77291465 |
| Molecular Formula | C29H36ClFN2O3Si |
| Molecular Weight | 543.16 g/mol |
| Exact Mass | 542.22 |
| IUPAC Name | [6-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-chloro-5-(2,6-dimethylmorpholin-4-yl)-3-fluoro-2-pyridinyl]methanol |
| SMILES | CC1CN(c2c(CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)nc(CO)c(F)c2Cl)CC(C)O1 |
| InChI | InChI=1S/C29H36ClFN2O3Si/c1-20-16-33(17-21(2)36-20)28-25(32-24(18-34)27(31)26(28)30)19-35-37(29(3,4)5,22-12-8-6-9-13-22)23-14-10-7-11-15-23/h6-15,20-21,34H,16-19H2,1-5H3 |
| InChIKey | FFRXNZVLDPSDDO-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 54.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.16 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|