C13H7F14N — CID 150117570
N-(1,2,2,3,3,4,4,5,5,6,6,7,7,7-tetradecafluoroheptyl)aniline (PubChem CID 150117570) has the molecular formula C13H7F14N and a molecular weight of 443.18 g/mol. Its IUPAC name is N-(1,2,2,3,3,4,4,5,5,6,6,7,7,7-tetradecafluoroheptyl)aniline.
| Compound Name | N-(1,2,2,3,3,4,4,5,5,6,6,7,7,7-tetradecafluoroheptyl)aniline |
|---|---|
| PubChem CID | 150117570 |
| Molecular Formula | C13H7F14N |
| Molecular Weight | 443.18 g/mol |
| Exact Mass | 443.04 |
| IUPAC Name | N-(1,2,2,3,3,4,4,5,5,6,6,7,7,7-tetradecafluoroheptyl)aniline |
| SMILES | FC(Nc1ccccc1)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H7F14N/c14-7(28-6-4-2-1-3-5-6)8(15,16)9(17,18)10(19,20)11(21,22)12(23,24)13(25,26)27/h1-5,7,28H |
| InChIKey | DYOMELLXLZPTBK-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.18 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|