About 1-bromohexylboronic acid
1-bromohexylboronic acid (PubChem CID 150147183) has the molecular formula C6H14BBrO2
and a molecular weight of 208.89 g/mol. Its IUPAC name is 1-bromohexylboronic acid.
Molecular Properties
| Compound Name | 1-bromohexylboronic acid |
| PubChem CID | 150147183 |
| Molecular Formula | C6H14BBrO2 |
| Molecular Weight | 208.89 g/mol |
| Exact Mass | 208.03 |
| IUPAC Name | 1-bromohexylboronic acid |
| SMILES | CCCCCC(Br)B(O)O |
| InChI | InChI=1S/C6H14BBrO2/c1-2-3-4-5-6(8)7(9)10/h6,9-10H,2-5H2,1H3 |
| InChIKey | FEMPEHAKBDCGHD-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.89 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-bromohexylboronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromohexylboronic acid?
The IUPAC name of 1-bromohexylboronic acid (CID 150147183) is 1-bromohexylboronic acid.
What is the SMILES notation for 1-bromohexylboronic acid?
The canonical SMILES for 1-bromohexylboronic acid is CCCCCC(Br)B(O)O.
What is the InChIKey of 1-bromohexylboronic acid?
The InChIKey is FEMPEHAKBDCGHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14BBrO2/c1-2-3-4-5-6(8)7(9)10/h6,9-10H,2-5H2,1H3.
What are the key properties of 1-bromohexylboronic acid?
1-bromohexylboronic acid has a molecular weight of 208.89 g/mol, XLogP of 1.34, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromohexylboronic acid is sourced from PubChem (CID 150147183), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).