About 1-boronooctylboronic acid
1-boronooctylboronic acid (PubChem CID 162767172) has the molecular formula C8H20B2O4
and a molecular weight of 201.87 g/mol. Its IUPAC name is 1-boronooctylboronic acid.
Molecular Properties
| Compound Name | 1-boronooctylboronic acid |
| PubChem CID | 162767172 |
| Molecular Formula | C8H20B2O4 |
| Molecular Weight | 201.87 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | 1-boronooctylboronic acid |
| SMILES | CCCCCCCC(B(O)O)B(O)O |
| InChI | InChI=1S/C8H20B2O4/c1-2-3-4-5-6-7-8(9(11)12)10(13)14/h8,11-14H,2-7H2,1H3 |
| InChIKey | UWAMZWQKIIRLLE-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.87 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-boronooctylboronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-boronooctylboronic acid?
The IUPAC name of 1-boronooctylboronic acid (CID 162767172) is 1-boronooctylboronic acid.
What is the SMILES notation for 1-boronooctylboronic acid?
The canonical SMILES for 1-boronooctylboronic acid is CCCCCCCC(B(O)O)B(O)O.
What is the InChIKey of 1-boronooctylboronic acid?
The InChIKey is UWAMZWQKIIRLLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H20B2O4/c1-2-3-4-5-6-7-8(9(11)12)10(13)14/h8,11-14H,2-7H2,1H3.
What are the key properties of 1-boronooctylboronic acid?
1-boronooctylboronic acid has a molecular weight of 201.87 g/mol, XLogP of 0.20, 8 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-boronooctylboronic acid is sourced from PubChem (CID 162767172), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).