C18H18BrNO4S — CID 150174230
3-(6-bromo-1,3-benzothiazol-2-yl)-1-ethyl-5-methylcyclohex-4-ene-1,3-dicarboxylic acid (PubChem CID 150174230) has the molecular formula C18H18BrNO4S and a molecular weight of 424.32 g/mol. Its IUPAC name is 3-(6-bromo-1,3-benzothiazol-2-yl)-1-ethyl-5-methylcyclohex-4-ene-1,3-dicarboxylic acid.
| Compound Name | 3-(6-bromo-1,3-benzothiazol-2-yl)-1-ethyl-5-methylcyclohex-4-ene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 150174230 |
| Molecular Formula | C18H18BrNO4S |
| Molecular Weight | 424.32 g/mol |
| Exact Mass | 423.01 |
| IUPAC Name | 3-(6-bromo-1,3-benzothiazol-2-yl)-1-ethyl-5-methylcyclohex-4-ene-1,3-dicarboxylic acid |
| SMILES | CCC1(C(=O)O)CC(C)=CC(C(=O)O)(c2nc3ccc(Br)cc3s2)C1 |
| InChI | InChI=1S/C18H18BrNO4S/c1-3-17(15(21)22)7-10(2)8-18(9-17,16(23)24)14-20-12-5-4-11(19)6-13(12)25-14/h4-6,8H,3,7,9H2,1-2H3,(H,21,22)(H,23,24) |
| InChIKey | FKBNWSWJMFIXDZ-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 87.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.32 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|