C30H33N5O2 — CID 150242398
4-benzoyl-N-[2-(benzylamino)ethyl]-3-(1H-indol-3-ylmethyl)piperazine-1-carboxamide (PubChem CID 150242398) has the molecular formula C30H33N5O2 and a molecular weight of 495.63 g/mol. Its IUPAC name is 4-benzoyl-N-[2-(benzylamino)ethyl]-3-(1H-indol-3-ylmethyl)piperazine-1-carboxamide.
| Compound Name | 4-benzoyl-N-[2-(benzylamino)ethyl]-3-(1H-indol-3-ylmethyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 150242398 |
| Molecular Formula | C30H33N5O2 |
| Molecular Weight | 495.63 g/mol |
| Exact Mass | 495.26 |
| IUPAC Name | 4-benzoyl-N-[2-(benzylamino)ethyl]-3-(1H-indol-3-ylmethyl)piperazine-1-carboxamide |
| SMILES | O=C(NCCNCc1ccccc1)N1CCN(C(=O)c2ccccc2)C(Cc2c[nH]c3ccccc23)C1 |
| InChI | InChI=1S/C30H33N5O2/c36-29(24-11-5-2-6-12-24)35-18-17-34(30(37)32-16-15-31-20-23-9-3-1-4-10-23)22-26(35)19-25-21-33-28-14-8-7-13-27(25)28/h1-14,21,26,31,33H,15-20,22H2,(H,32,37) |
| InChIKey | FXULPZOBJFBDTI-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.63 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|