C9H14O2S — CID 15026003
1-[(E)-but-2-enyl]sulfonyl-3-methylbuta-1,2-diene (PubChem CID 15026003) has the molecular formula C9H14O2S and a molecular weight of 186.28 g/mol. Its IUPAC name is 1-[(E)-but-2-enyl]sulfonyl-3-methylbuta-1,2-diene.
| Compound Name | 1-[(E)-but-2-enyl]sulfonyl-3-methylbuta-1,2-diene |
|---|---|
| PubChem CID | 15026003 |
| Molecular Formula | C9H14O2S |
| Molecular Weight | 186.28 g/mol |
| Exact Mass | 186.07 |
| IUPAC Name | 1-[(E)-but-2-enyl]sulfonyl-3-methylbuta-1,2-diene |
| SMILES | C/C=C/CS(=O)(=O)C=C=C(C)C |
| InChI | InChI=1S/C9H14O2S/c1-4-5-7-12(10,11)8-6-9(2)3/h4-5,8H,7H2,1-3H3/b5-4+ |
| InChIKey | ZQEMUROYUWGWRP-SNAWJCMRSA-N |
| XLogP | 2.06 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.28 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|