C16H15F3N2O — CID 150300315
1-[3-ethyl-6-[4-(trifluoromethyl)anilino]-2-pyridinyl]ethanone (PubChem CID 150300315) has the molecular formula C16H15F3N2O and a molecular weight of 308.30 g/mol. Its IUPAC name is 1-[3-ethyl-6-[4-(trifluoromethyl)anilino]-2-pyridinyl]ethanone.
| Compound Name | 1-[3-ethyl-6-[4-(trifluoromethyl)anilino]-2-pyridinyl]ethanone |
|---|---|
| PubChem CID | 150300315 |
| Molecular Formula | C16H15F3N2O |
| Molecular Weight | 308.30 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | 1-[3-ethyl-6-[4-(trifluoromethyl)anilino]-2-pyridinyl]ethanone |
| SMILES | CCc1ccc(Nc2ccc(C(F)(F)F)cc2)nc1C(C)=O |
| InChI | InChI=1S/C16H15F3N2O/c1-3-11-4-9-14(21-15(11)10(2)22)20-13-7-5-12(6-8-13)16(17,18)19/h4-9H,3H2,1-2H3,(H,20,21) |
| InChIKey | GJLVAJAKAOQMIQ-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.30 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |