C54H56N8O2S — CID 150306139
tert-butyl N-[2-amino-5-[[5-ethyl-2-propyl-1-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]methylsulfanyl]phenyl]-N-methylcarbamate (PubChem CID 150306139) has the molecular formula C54H56N8O2S and a molecular weight of 881.16 g/mol. Its IUPAC name is tert-butyl N-[2-amino-5-[[5-ethyl-2-propyl-1-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]methylsulfanyl]phenyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[2-amino-5-[[5-ethyl-2-propyl-1-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]methylsulfanyl]phenyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 150306139 |
| Molecular Formula | C54H56N8O2S |
| Molecular Weight | 881.16 g/mol |
| Exact Mass | 880.42 |
| IUPAC Name | tert-butyl N-[2-amino-5-[[5-ethyl-2-propyl-1-[[4-[2-(1-trityltetrazol-5-yl)phenyl]phenyl]methyl]imidazol-4-yl]methylsulfanyl]phenyl]-N-methylcarbamate |
| SMILES | CCCc1nc(CSc2ccc(N)c(N(C)C(=O)OC(C)(C)C)c2)c(CC)n1Cc1ccc(-c2ccccc2-c2nnnn2C(c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C54H56N8O2S/c1-7-20-50-56-47(37-65-43-33-34-46(55)49(35-43)60(6)52(63)64-53(3,4)5)48(8-2)61(50)36-38-29-31-39(32-30-38)44-27-18-19-28-45(44)51-57-58-59-62(51)54(40-21-12-9-13-22-40,41-23-14-10-15-24-41)42-25-16-11-17-26-42/h9-19,21-35H,7-8,20,36-37,55H2,1-6H3 |
| InChIKey | GKQBQRLEYPIKCU-UHFFFAOYSA-N |
| XLogP | 11.85 |
| TPSA | 116.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 881.16 |
| LogP ≤ 5 | 11.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|