C16H20N2O5 — CID 150313874
[4-(3-amino-2-oxoazepane-4-carbonyl)phenyl] ethyl carbonate (PubChem CID 150313874) has the molecular formula C16H20N2O5 and a molecular weight of 320.35 g/mol. Its IUPAC name is [4-(3-amino-2-oxoazepane-4-carbonyl)phenyl] ethyl carbonate.
| Compound Name | [4-(3-amino-2-oxoazepane-4-carbonyl)phenyl] ethyl carbonate |
|---|---|
| PubChem CID | 150313874 |
| Molecular Formula | C16H20N2O5 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | [4-(3-amino-2-oxoazepane-4-carbonyl)phenyl] ethyl carbonate |
| SMILES | CCOC(=O)Oc1ccc(C(=O)C2CCCNC(=O)C2N)cc1 |
| InChI | InChI=1S/C16H20N2O5/c1-2-22-16(21)23-11-7-5-10(6-8-11)14(19)12-4-3-9-18-15(20)13(12)17/h5-8,12-13H,2-4,9,17H2,1H3,(H,18,20) |
| InChIKey | GMERAMFDDQFTSM-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|