C16H24O3 — CID 150340384
(2-hydroxy-3,5-dimethyl-1-adamantyl) 2-methylprop-2-enoate (PubChem CID 150340384) has the molecular formula C16H24O3 and a molecular weight of 264.36 g/mol. Its IUPAC name is (2-hydroxy-3,5-dimethyl-1-adamantyl) 2-methylprop-2-enoate.
| Compound Name | (2-hydroxy-3,5-dimethyl-1-adamantyl) 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 150340384 |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.36 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | (2-hydroxy-3,5-dimethyl-1-adamantyl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC12CC3CC(C)(CC(C)(C3)C1O)C2 |
| InChI | InChI=1S/C16H24O3/c1-10(2)12(17)19-16-7-11-5-14(3,9-16)8-15(4,6-11)13(16)18/h11,13,18H,1,5-9H2,2-4H3 |
| InChIKey | GROWRNZBXJAXDU-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.36 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|