C14H23NO2 — CID 139966238
(2-amino-5,7-dimethyl-1-adamantyl) acetate (PubChem CID 139966238) has the molecular formula C14H23NO2 and a molecular weight of 237.34 g/mol. Its IUPAC name is (2-amino-5,7-dimethyl-1-adamantyl) acetate.
| Compound Name | (2-amino-5,7-dimethyl-1-adamantyl) acetate |
|---|---|
| PubChem CID | 139966238 |
| Molecular Formula | C14H23NO2 |
| Molecular Weight | 237.34 g/mol |
| Exact Mass | 237.17 |
| IUPAC Name | (2-amino-5,7-dimethyl-1-adamantyl) acetate |
| SMILES | CC(=O)OC12CC3(C)CC(CC(C)(C3)C1)C2N |
| InChI | InChI=1S/C14H23NO2/c1-9(16)17-14-7-12(2)4-10(11(14)15)5-13(3,6-12)8-14/h10-11H,4-8,15H2,1-3H3 |
| InChIKey | ZYOULQXCWAEHMR-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.34 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |