C16H25NO2 — CID 174753683
N-acetyl-N-(3,5-dimethyl-1-adamantyl)acetamide (PubChem CID 174753683) has the molecular formula C16H25NO2 and a molecular weight of 263.38 g/mol. Its IUPAC name is N-acetyl-N-(3,5-dimethyl-1-adamantyl)acetamide.
| Compound Name | N-acetyl-N-(3,5-dimethyl-1-adamantyl)acetamide |
|---|---|
| PubChem CID | 174753683 |
| Molecular Formula | C16H25NO2 |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.19 |
| IUPAC Name | N-acetyl-N-(3,5-dimethyl-1-adamantyl)acetamide |
| SMILES | CC(=O)N(C(C)=O)C12CC3CC(C)(CC(C)(C3)C1)C2 |
| InChI | InChI=1S/C16H25NO2/c1-11(18)17(12(2)19)16-7-13-5-14(3,9-16)8-15(4,6-13)10-16/h13H,5-10H2,1-4H3 |
| InChIKey | AAASGSVFNADKLL-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |