C10H20ClNO3S — CID 15035854
tert-butyl N-[2-(3-chloro-2-hydroxypropyl)sulfanylethyl]carbamate (PubChem CID 15035854) has the molecular formula C10H20ClNO3S and a molecular weight of 269.79 g/mol. Its IUPAC name is tert-butyl N-[2-(3-chloro-2-hydroxypropyl)sulfanylethyl]carbamate.
| Compound Name | tert-butyl N-[2-(3-chloro-2-hydroxypropyl)sulfanylethyl]carbamate |
|---|---|
| PubChem CID | 15035854 |
| Molecular Formula | C10H20ClNO3S |
| Molecular Weight | 269.79 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | tert-butyl N-[2-(3-chloro-2-hydroxypropyl)sulfanylethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCSCC(O)CCl |
| InChI | InChI=1S/C10H20ClNO3S/c1-10(2,3)15-9(14)12-4-5-16-7-8(13)6-11/h8,13H,4-7H2,1-3H3,(H,12,14) |
| InChIKey | LFTNGLIVHOVMSS-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.79 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|