C15H29NO4S — CID 86645530
tert-butyl 2-methyl-2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylsulfanyl]propanoate (PubChem CID 86645530) has the molecular formula C15H29NO4S and a molecular weight of 319.47 g/mol. Its IUPAC name is tert-butyl 2-methyl-2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylsulfanyl]propanoate.
| Compound Name | tert-butyl 2-methyl-2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylsulfanyl]propanoate |
|---|---|
| PubChem CID | 86645530 |
| Molecular Formula | C15H29NO4S |
| Molecular Weight | 319.47 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | tert-butyl 2-methyl-2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylsulfanyl]propanoate |
| SMILES | CC(C)(C)OC(=O)NCCSC(C)(C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H29NO4S/c1-13(2,3)19-11(17)15(7,8)21-10-9-16-12(18)20-14(4,5)6/h9-10H2,1-8H3,(H,16,18) |
| InChIKey | OHQPTRNULPRKJP-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.47 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|