C36H34N6O3 — CID 150387768
[6-amino-9-[(2S,4R,5S)-2-amino-5-(hydroxymethyl)-4-trityloxolan-2-yl]-8H-purin-6-yl]-phenylmethanone (PubChem CID 150387768) has the molecular formula C36H34N6O3 and a molecular weight of 598.71 g/mol. Its IUPAC name is [6-amino-9-[(2S,4R,5S)-2-amino-5-(hydroxymethyl)-4-trityloxolan-2-yl]-8H-purin-6-yl]-phenylmethanone.
| Compound Name | [6-amino-9-[(2S,4R,5S)-2-amino-5-(hydroxymethyl)-4-trityloxolan-2-yl]-8H-purin-6-yl]-phenylmethanone |
|---|---|
| PubChem CID | 150387768 |
| Molecular Formula | C36H34N6O3 |
| Molecular Weight | 598.71 g/mol |
| Exact Mass | 598.27 |
| IUPAC Name | [6-amino-9-[(2S,4R,5S)-2-amino-5-(hydroxymethyl)-4-trityloxolan-2-yl]-8H-purin-6-yl]-phenylmethanone |
| SMILES | NC1(C(=O)c2ccccc2)N=CN=C2C1=NCN2[C@@]1(N)C[C@H](C(c2ccccc2)(c2ccccc2)c2ccccc2)[C@@H](CO)O1 |
| InChI | InChI=1S/C36H34N6O3/c37-34(42-24-40-31-33(42)39-23-41-36(31,38)32(44)25-13-5-1-6-14-25)21-29(30(22-43)45-34)35(26-15-7-2-8-16-26,27-17-9-3-10-18-27)28-19-11-4-12-20-28/h1-20,23,29-30,43H,21-22,24,37-38H2/t29-,30+,34-,36?/m0/s1 |
| InChIKey | HBBBXXDPCUUPJR-QJYLMHPMSA-N |
| XLogP | 3.72 |
| TPSA | 138.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.71 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|