C24H42O3 — CID 150388184
2,3-dimethoxy-5-methyl-6-(3,7,11-trimethyldodeca-2,6,10-trienyl)cyclohexan-1-ol (PubChem CID 150388184) has the molecular formula C24H42O3 and a molecular weight of 378.60 g/mol. Its IUPAC name is 2,3-dimethoxy-5-methyl-6-(3,7,11-trimethyldodeca-2,6,10-trienyl)cyclohexan-1-ol.
| Compound Name | 2,3-dimethoxy-5-methyl-6-(3,7,11-trimethyldodeca-2,6,10-trienyl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 150388184 |
| Molecular Formula | C24H42O3 |
| Molecular Weight | 378.60 g/mol |
| Exact Mass | 378.31 |
| IUPAC Name | 2,3-dimethoxy-5-methyl-6-(3,7,11-trimethyldodeca-2,6,10-trienyl)cyclohexan-1-ol |
| SMILES | COC1CC(C)C(CC=C(C)CCC=C(C)CCC=C(C)C)C(O)C1OC |
| InChI | InChI=1S/C24H42O3/c1-17(2)10-8-11-18(3)12-9-13-19(4)14-15-21-20(5)16-22(26-6)24(27-7)23(21)25/h10,12,14,20-25H,8-9,11,13,15-16H2,1-7H3 |
| InChIKey | HBDLSXORPLJBDN-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.60 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|