C23H21F2NO2 — CID 15038956
(E,2R)-3,3-difluoro-3-phenyl-N,2-bis(phenylmethoxy)propan-1-imine (PubChem CID 15038956) has the molecular formula C23H21F2NO2 and a molecular weight of 381.42 g/mol. Its IUPAC name is (E,2R)-3,3-difluoro-3-phenyl-N,2-bis(phenylmethoxy)propan-1-imine.
| Compound Name | (E,2R)-3,3-difluoro-3-phenyl-N,2-bis(phenylmethoxy)propan-1-imine |
|---|---|
| PubChem CID | 15038956 |
| Molecular Formula | C23H21F2NO2 |
| Molecular Weight | 381.42 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | (E,2R)-3,3-difluoro-3-phenyl-N,2-bis(phenylmethoxy)propan-1-imine |
| SMILES | FC(F)(c1ccccc1)[C@@H](/C=N/OCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C23H21F2NO2/c24-23(25,21-14-8-3-9-15-21)22(27-17-19-10-4-1-5-11-19)16-26-28-18-20-12-6-2-7-13-20/h1-16,22H,17-18H2/b26-16+/t22-/m1/s1 |
| InChIKey | YWLFJJJGGLJXSQ-XDEFOSFOSA-N |
| XLogP | 5.57 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.42 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|