C22H21F3NO4- — CID 150411797
2-[4-methoxy-3-[[4-(trifluoromethyl)phenyl]methoxymethyl]-1H-indol-2-yl]butanoate (PubChem CID 150411797) has the molecular formula C22H21F3NO4- and a molecular weight of 420.41 g/mol. Its IUPAC name is 2-[4-methoxy-3-[[4-(trifluoromethyl)phenyl]methoxymethyl]-1H-indol-2-yl]butanoate.
| Compound Name | 2-[4-methoxy-3-[[4-(trifluoromethyl)phenyl]methoxymethyl]-1H-indol-2-yl]butanoate |
|---|---|
| PubChem CID | 150411797 |
| Molecular Formula | C22H21F3NO4- |
| Molecular Weight | 420.41 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | 2-[4-methoxy-3-[[4-(trifluoromethyl)phenyl]methoxymethyl]-1H-indol-2-yl]butanoate |
| SMILES | CCC(C(=O)[O-])c1[nH]c2cccc(OC)c2c1COCc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C22H22F3NO4/c1-3-15(21(27)28)20-16(19-17(26-20)5-4-6-18(19)29-2)12-30-11-13-7-9-14(10-8-13)22(23,24)25/h4-10,15,26H,3,11-12H2,1-2H3,(H,27,28)/p-1 |
| InChIKey | HFXZBJOQLSXOSJ-UHFFFAOYSA-M |
| XLogP | 4.16 |
| TPSA | 74.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.41 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |