About [(E,2S)-4-[tert-butyl(diphenyl)silyl]but-3-en-2-yl] 2-methoxyacetate
[(E,2S)-4-[tert-butyl(diphenyl)silyl]but-3-en-2-yl] 2-methoxyacetate (PubChem CID 15049408) has the molecular formula C23H30O3Si
and a molecular weight of 382.58 g/mol. Its IUPAC name is [(E,2S)-4-[tert-butyl(diphenyl)silyl]but-3-en-2-yl] 2-methoxyacetate.
Molecular Properties
| Compound Name | [(E,2S)-4-[tert-butyl(diphenyl)silyl]but-3-en-2-yl] 2-methoxyacetate |
| PubChem CID | 15049408 |
| Molecular Formula | C23H30O3Si |
| Molecular Weight | 382.58 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | [(E,2S)-4-[tert-butyl(diphenyl)silyl]but-3-en-2-yl] 2-methoxyacetate |
| SMILES | COCC(=O)O[C@@H](C)/C=C/[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C23H30O3Si/c1-19(26-22(24)18-25-5)16-17-27(23(2,3)4,20-12-8-6-9-13-20)21-14-10-7-11-15-21/h6-17,19H,18H2,1-5H3/b17-16+/t19-/m0/s1 |
| InChIKey | PNTNQHZZKRKSSN-PIOKWQJESA-N |
| XLogP | 3.72 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.58 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [(E,2S)-4-[tert-butyl(diphenyl)silyl]but-3-en-2-yl] 2-methoxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E,2S)-4-[tert-butyl(diphenyl)silyl]but-3-en-2-yl] 2-methoxyacetate?
The IUPAC name of [(E,2S)-4-[tert-butyl(diphenyl)silyl]but-3-en-2-yl] 2-methoxyacetate (CID 15049408) is [(E,2S)-4-[tert-butyl(diphenyl)silyl]but-3-en-2-yl] 2-methoxyacetate.
What is the SMILES notation for [(E,2S)-4-[tert-butyl(diphenyl)silyl]but-3-en-2-yl] 2-methoxyacetate?
The canonical SMILES for [(E,2S)-4-[tert-butyl(diphenyl)silyl]but-3-en-2-yl] 2-methoxyacetate is COCC(=O)O[C@@H](C)/C=C/[Si](c1ccccc1)(c1ccccc1)C(C)(C)C.
What is the InChIKey of [(E,2S)-4-[tert-butyl(diphenyl)silyl]but-3-en-2-yl] 2-methoxyacetate?
The InChIKey is PNTNQHZZKRKSSN-PIOKWQJESA-N. The full InChI is InChI=1S/C23H30O3Si/c1-19(26-22(24)18-25-5)16-17-27(23(2,3)4,20-12-8-6-9-13-20)21-14-10-7-11-15-21/h6-17,19H,18H2,1-5H3/b17-16+/t19-/m0/s1.
What are the key properties of [(E,2S)-4-[tert-butyl(diphenyl)silyl]but-3-en-2-yl] 2-methoxyacetate?
[(E,2S)-4-[tert-butyl(diphenyl)silyl]but-3-en-2-yl] 2-methoxyacetate has a molecular weight of 382.58 g/mol, XLogP of 3.72, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(E,2S)-4-[tert-butyl(diphenyl)silyl]but-3-en-2-yl] 2-methoxyacetate is sourced from PubChem (CID 15049408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).