C23H30O3Si — CID 15049408
[(E,2S)-4-[tert-butyl(diphenyl)silyl]but-3-en-2-yl] 2-methoxyacetate (PubChem CID 15049408) has the molecular formula C23H30O3Si and a molecular weight of 382.58 g/mol. Its IUPAC name is [(E,2S)-4-[tert-butyl(diphenyl)silyl]but-3-en-2-yl] 2-methoxyacetate.
| Compound Name | [(E,2S)-4-[tert-butyl(diphenyl)silyl]but-3-en-2-yl] 2-methoxyacetate |
|---|---|
| PubChem CID | 15049408 |
| Molecular Formula | C23H30O3Si |
| Molecular Weight | 382.58 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | [(E,2S)-4-[tert-butyl(diphenyl)silyl]but-3-en-2-yl] 2-methoxyacetate |
| SMILES | COCC(=O)O[C@@H](C)/C=C/[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C23H30O3Si/c1-19(26-22(24)18-25-5)16-17-27(23(2,3)4,20-12-8-6-9-13-20)21-14-10-7-11-15-21/h6-17,19H,18H2,1-5H3/b17-16+/t19-/m0/s1 |
| InChIKey | PNTNQHZZKRKSSN-PIOKWQJESA-N |
| XLogP | 3.72 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.58 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|