C26H34N4O8 — CID 150508566
tert-butyl (2R)-2-[3-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]propoxymethyl]morpholine-4-carboxylate (PubChem CID 150508566) has the molecular formula C26H34N4O8 and a molecular weight of 530.58 g/mol. Its IUPAC name is tert-butyl (2R)-2-[3-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]propoxymethyl]morpholine-4-carboxylate.
| Compound Name | tert-butyl (2R)-2-[3-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]propoxymethyl]morpholine-4-carboxylate |
|---|---|
| PubChem CID | 150508566 |
| Molecular Formula | C26H34N4O8 |
| Molecular Weight | 530.58 g/mol |
| Exact Mass | 530.24 |
| IUPAC Name | tert-butyl (2R)-2-[3-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]amino]propoxymethyl]morpholine-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCO[C@@H](COCCCNc2cccc3c2C(=O)N(C2CCC(=O)NC2=O)C3=O)C1 |
| InChI | InChI=1S/C26H34N4O8/c1-26(2,3)38-25(35)29-11-13-37-16(14-29)15-36-12-5-10-27-18-7-4-6-17-21(18)24(34)30(23(17)33)19-8-9-20(31)28-22(19)32/h4,6-7,16,19,27H,5,8-15H2,1-3H3,(H,28,31,32)/t16-,19?/m1/s1 |
| InChIKey | HZIQSZMLXLLWOZ-VTBWFHPJSA-N |
| XLogP | 1.54 |
| TPSA | 143.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.58 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|