C25H33N5O8 — CID 165383524
tert-butyl (2S)-2-[3-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxopyrrolo[3,4-c]pyridin-4-yl]amino]propoxymethyl]morpholine-4-carboxylate (PubChem CID 165383524) has the molecular formula C25H33N5O8 and a molecular weight of 531.57 g/mol. Its IUPAC name is tert-butyl (2S)-2-[3-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxopyrrolo[3,4-c]pyridin-4-yl]amino]propoxymethyl]morpholine-4-carboxylate.
| Compound Name | tert-butyl (2S)-2-[3-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxopyrrolo[3,4-c]pyridin-4-yl]amino]propoxymethyl]morpholine-4-carboxylate |
|---|---|
| PubChem CID | 165383524 |
| Molecular Formula | C25H33N5O8 |
| Molecular Weight | 531.57 g/mol |
| Exact Mass | 531.23 |
| IUPAC Name | tert-butyl (2S)-2-[3-[[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxopyrrolo[3,4-c]pyridin-4-yl]amino]propoxymethyl]morpholine-4-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCO[C@H](COCCCNc2nccc3c2C(=O)N(C2CCC(=O)NC2=O)C3=O)C1 |
| InChI | InChI=1S/C25H33N5O8/c1-25(2,3)38-24(35)29-10-12-37-15(13-29)14-36-11-4-8-26-20-19-16(7-9-27-20)22(33)30(23(19)34)17-5-6-18(31)28-21(17)32/h7,9,15,17H,4-6,8,10-14H2,1-3H3,(H,26,27)(H,28,31,32)/t15-,17?/m0/s1 |
| InChIKey | JYQWVCLCFGCRHP-MYJWUSKBSA-N |
| XLogP | 0.94 |
| TPSA | 156.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.57 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|