C13H20FN3O2 — CID 150523902
[1-[2-amino-5-(dimethylamino)-4-fluorophenyl]-2-methylpropan-2-yl] carbamate (PubChem CID 150523902) has the molecular formula C13H20FN3O2 and a molecular weight of 269.32 g/mol. Its IUPAC name is [1-[2-amino-5-(dimethylamino)-4-fluorophenyl]-2-methylpropan-2-yl] carbamate.
| Compound Name | [1-[2-amino-5-(dimethylamino)-4-fluorophenyl]-2-methylpropan-2-yl] carbamate |
|---|---|
| PubChem CID | 150523902 |
| Molecular Formula | C13H20FN3O2 |
| Molecular Weight | 269.32 g/mol |
| Exact Mass | 269.15 |
| IUPAC Name | [1-[2-amino-5-(dimethylamino)-4-fluorophenyl]-2-methylpropan-2-yl] carbamate |
| SMILES | CN(C)c1cc(CC(C)(C)OC(N)=O)c(N)cc1F |
| InChI | InChI=1S/C13H20FN3O2/c1-13(2,19-12(16)18)7-8-5-11(17(3)4)9(14)6-10(8)15/h5-6H,7,15H2,1-4H3,(H2,16,18) |
| InChIKey | ICKFVDLAKKDPPW-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 81.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.32 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|