C16H24F3N3O2 — CID 150567975
[1-[2-amino-5-(2-methylpropylamino)-4-(trifluoromethyl)phenyl]-2-methylpropan-2-yl] carbamate (PubChem CID 150567975) has the molecular formula C16H24F3N3O2 and a molecular weight of 347.38 g/mol. Its IUPAC name is [1-[2-amino-5-(2-methylpropylamino)-4-(trifluoromethyl)phenyl]-2-methylpropan-2-yl] carbamate.
| Compound Name | [1-[2-amino-5-(2-methylpropylamino)-4-(trifluoromethyl)phenyl]-2-methylpropan-2-yl] carbamate |
|---|---|
| PubChem CID | 150567975 |
| Molecular Formula | C16H24F3N3O2 |
| Molecular Weight | 347.38 g/mol |
| Exact Mass | 347.18 |
| IUPAC Name | [1-[2-amino-5-(2-methylpropylamino)-4-(trifluoromethyl)phenyl]-2-methylpropan-2-yl] carbamate |
| SMILES | CC(C)CNc1cc(CC(C)(C)OC(N)=O)c(N)cc1C(F)(F)F |
| InChI | InChI=1S/C16H24F3N3O2/c1-9(2)8-22-13-5-10(7-15(3,4)24-14(21)23)12(20)6-11(13)16(17,18)19/h5-6,9,22H,7-8,20H2,1-4H3,(H2,21,23) |
| InChIKey | ILFODKSAVGXKEQ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 90.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.38 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|