C17H24F3N3O4 — CID 151029780
[2-methyl-1-[5-[methyl(2-methylpropyl)amino]-2-nitro-4-(trifluoromethyl)phenyl]propan-2-yl] carbamate (PubChem CID 151029780) has the molecular formula C17H24F3N3O4 and a molecular weight of 391.39 g/mol. Its IUPAC name is [2-methyl-1-[5-[methyl(2-methylpropyl)amino]-2-nitro-4-(trifluoromethyl)phenyl]propan-2-yl] carbamate.
| Compound Name | [2-methyl-1-[5-[methyl(2-methylpropyl)amino]-2-nitro-4-(trifluoromethyl)phenyl]propan-2-yl] carbamate |
|---|---|
| PubChem CID | 151029780 |
| Molecular Formula | C17H24F3N3O4 |
| Molecular Weight | 391.39 g/mol |
| Exact Mass | 391.17 |
| IUPAC Name | [2-methyl-1-[5-[methyl(2-methylpropyl)amino]-2-nitro-4-(trifluoromethyl)phenyl]propan-2-yl] carbamate |
| SMILES | CC(C)CN(C)c1cc(CC(C)(C)OC(N)=O)c([N+](=O)[O-])cc1C(F)(F)F |
| InChI | InChI=1S/C17H24F3N3O4/c1-10(2)9-22(5)14-6-11(8-16(3,4)27-15(21)24)13(23(25)26)7-12(14)17(18,19)20/h6-7,10H,8-9H2,1-5H3,(H2,21,24) |
| InChIKey | LZUSRMRHRNPSNL-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 98.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.39 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|