C16H22F3N3O2 — CID 151943359
[1-[2-amino-5-[cyclopropyl(methyl)amino]-4-(trifluoromethyl)phenyl]-2-methylpropan-2-yl] carbamate (PubChem CID 151943359) has the molecular formula C16H22F3N3O2 and a molecular weight of 345.37 g/mol. Its IUPAC name is [1-[2-amino-5-[cyclopropyl(methyl)amino]-4-(trifluoromethyl)phenyl]-2-methylpropan-2-yl] carbamate.
| Compound Name | [1-[2-amino-5-[cyclopropyl(methyl)amino]-4-(trifluoromethyl)phenyl]-2-methylpropan-2-yl] carbamate |
|---|---|
| PubChem CID | 151943359 |
| Molecular Formula | C16H22F3N3O2 |
| Molecular Weight | 345.37 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | [1-[2-amino-5-[cyclopropyl(methyl)amino]-4-(trifluoromethyl)phenyl]-2-methylpropan-2-yl] carbamate |
| SMILES | CN(c1cc(CC(C)(C)OC(N)=O)c(N)cc1C(F)(F)F)C1CC1 |
| InChI | InChI=1S/C16H22F3N3O2/c1-15(2,24-14(21)23)8-9-6-13(22(3)10-4-5-10)11(7-12(9)20)16(17,18)19/h6-7,10H,4-5,8,20H2,1-3H3,(H2,21,23) |
| InChIKey | TVDHFYXADCTHNW-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 81.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.37 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|