C16H22F3N3O4 — CID 172725434
[2-methyl-1-[5-(2-methylpropylamino)-2-nitro-4-(trifluoromethyl)phenyl]propan-2-yl] carbamate (PubChem CID 172725434) has the molecular formula C16H22F3N3O4 and a molecular weight of 377.36 g/mol. Its IUPAC name is [2-methyl-1-[5-(2-methylpropylamino)-2-nitro-4-(trifluoromethyl)phenyl]propan-2-yl] carbamate.
| Compound Name | [2-methyl-1-[5-(2-methylpropylamino)-2-nitro-4-(trifluoromethyl)phenyl]propan-2-yl] carbamate |
|---|---|
| PubChem CID | 172725434 |
| Molecular Formula | C16H22F3N3O4 |
| Molecular Weight | 377.36 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | [2-methyl-1-[5-(2-methylpropylamino)-2-nitro-4-(trifluoromethyl)phenyl]propan-2-yl] carbamate |
| SMILES | CC(C)CNc1cc(CC(C)(C)OC(N)=O)c([N+](=O)[O-])cc1C(F)(F)F |
| InChI | InChI=1S/C16H22F3N3O4/c1-9(2)8-21-12-5-10(7-15(3,4)26-14(20)23)13(22(24)25)6-11(12)16(17,18)19/h5-6,9,21H,7-8H2,1-4H3,(H2,20,23) |
| InChIKey | HBTVJWRDYCMAJP-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 107.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.36 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|