C17H26F3N3O2 — CID 151366514
[1-[2-amino-5-[methyl(2-methylpropyl)amino]-4-(trifluoromethyl)phenyl]-2-methylpropan-2-yl] carbamate (PubChem CID 151366514) has the molecular formula C17H26F3N3O2 and a molecular weight of 361.41 g/mol. Its IUPAC name is [1-[2-amino-5-[methyl(2-methylpropyl)amino]-4-(trifluoromethyl)phenyl]-2-methylpropan-2-yl] carbamate.
| Compound Name | [1-[2-amino-5-[methyl(2-methylpropyl)amino]-4-(trifluoromethyl)phenyl]-2-methylpropan-2-yl] carbamate |
|---|---|
| PubChem CID | 151366514 |
| Molecular Formula | C17H26F3N3O2 |
| Molecular Weight | 361.41 g/mol |
| Exact Mass | 361.20 |
| IUPAC Name | [1-[2-amino-5-[methyl(2-methylpropyl)amino]-4-(trifluoromethyl)phenyl]-2-methylpropan-2-yl] carbamate |
| SMILES | CC(C)CN(C)c1cc(CC(C)(C)OC(N)=O)c(N)cc1C(F)(F)F |
| InChI | InChI=1S/C17H26F3N3O2/c1-10(2)9-23(5)14-6-11(8-16(3,4)25-15(22)24)13(21)7-12(14)17(18,19)20/h6-7,10H,8-9,21H2,1-5H3,(H2,22,24) |
| InChIKey | OPNVJXRECDSQPG-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 81.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.41 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|